About nitro 2-aminoethanesulfonate
nitro 2-aminoethanesulfonate (PubChem CID 87409443) has the molecular formula C2H6N2O5S
and a molecular weight of 170.15 g/mol. Its IUPAC name is nitro 2-aminoethanesulfonate.
Molecular Properties
| Compound Name | nitro 2-aminoethanesulfonate |
| PubChem CID | 87409443 |
| Molecular Formula | C2H6N2O5S |
| Molecular Weight | 170.15 g/mol |
| Exact Mass | 170.00 |
| IUPAC Name | nitro 2-aminoethanesulfonate |
| SMILES | NCCS(=O)(=O)O[N+](=O)[O-] |
| InChI | InChI=1S/C2H6N2O5S/c3-1-2-10(7,8)9-4(5)6/h1-3H2 |
| InChIKey | OYMWONQCQPGYGF-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.15 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitro 2-aminoethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitro 2-aminoethanesulfonate?
The IUPAC name of nitro 2-aminoethanesulfonate (CID 87409443) is nitro 2-aminoethanesulfonate.
What is the SMILES notation for nitro 2-aminoethanesulfonate?
The canonical SMILES for nitro 2-aminoethanesulfonate is NCCS(=O)(=O)O[N+](=O)[O-].
What is the InChIKey of nitro 2-aminoethanesulfonate?
The InChIKey is OYMWONQCQPGYGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O5S/c3-1-2-10(7,8)9-4(5)6/h1-3H2.
What are the key properties of nitro 2-aminoethanesulfonate?
nitro 2-aminoethanesulfonate has a molecular weight of 170.15 g/mol, XLogP of -1.52, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for nitro 2-aminoethanesulfonate is sourced from PubChem (CID 87409443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).