About trans-(1S,3S)-1,3-diisocyanatocyclohexane
trans-(1S,3S)-1,3-diisocyanatocyclohexane (PubChem CID 87409790) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is trans-(1S,3S)-1,3-diisocyanatocyclohexane.
Molecular Properties
| Compound Name | trans-(1S,3S)-1,3-diisocyanatocyclohexane |
| PubChem CID | 87409790 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | trans-(1S,3S)-1,3-diisocyanatocyclohexane |
| SMILES | O=C=N[C@H]1CCC[C@H](N=C=O)C1 |
| InChI | InChI=1S/C8H10N2O2/c11-5-9-7-2-1-3-8(4-7)10-6-12/h7-8H,1-4H2/t7-,8-/m0/s1 |
| InChIKey | GNQKHBSIBXSFFD-YUMQZZPRSA-N |
| XLogP | 0.97 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,3S)-1,3-diisocyanatocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,3S)-1,3-diisocyanatocyclohexane?
The IUPAC name of trans-(1S,3S)-1,3-diisocyanatocyclohexane (CID 87409790) is trans-(1S,3S)-1,3-diisocyanatocyclohexane.
What is the SMILES notation for trans-(1S,3S)-1,3-diisocyanatocyclohexane?
The canonical SMILES for trans-(1S,3S)-1,3-diisocyanatocyclohexane is O=C=N[C@H]1CCC[C@H](N=C=O)C1.
What is the InChIKey of trans-(1S,3S)-1,3-diisocyanatocyclohexane?
The InChIKey is GNQKHBSIBXSFFD-YUMQZZPRSA-N. The full InChI is InChI=1S/C8H10N2O2/c11-5-9-7-2-1-3-8(4-7)10-6-12/h7-8H,1-4H2/t7-,8-/m0/s1.
What are the key properties of trans-(1S,3S)-1,3-diisocyanatocyclohexane?
trans-(1S,3S)-1,3-diisocyanatocyclohexane has a molecular weight of 166.18 g/mol, XLogP of 0.97, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,3S)-1,3-diisocyanatocyclohexane is sourced from PubChem (CID 87409790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).