C26H36N5S+ — CID 87410242
3-(1,4-diazepan-1-ium-1-ylidene)-7-(1,4-diazepan-1-yl)-1,9-diethylphenothiazine (PubChem CID 87410242) has the molecular formula C26H36N5S+ and a molecular weight of 450.68 g/mol. Its IUPAC name is 3-(1,4-diazepan-1-ium-1-ylidene)-7-(1,4-diazepan-1-yl)-1,9-diethylphenothiazine.
| Compound Name | 3-(1,4-diazepan-1-ium-1-ylidene)-7-(1,4-diazepan-1-yl)-1,9-diethylphenothiazine |
|---|---|
| PubChem CID | 87410242 |
| Molecular Formula | C26H36N5S+ |
| Molecular Weight | 450.68 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | 3-(1,4-diazepan-1-ium-1-ylidene)-7-(1,4-diazepan-1-yl)-1,9-diethylphenothiazine |
| SMILES | CCc1c/c(=[N+]2/CCCNCC2)cc2sc3cc(N4CCCNCC4)cc(CC)c3nc1-2 |
| InChI | InChI=1S/C26H36N5S/c1-3-19-15-21(30-11-5-7-27-9-13-30)17-23-25(19)29-26-20(4-2)16-22(18-24(26)32-23)31-12-6-8-28-10-14-31/h15-18,27-28H,3-14H2,1-2H3/q+1 |
| InChIKey | OMDFDLYLLYMNTH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.68 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|