C23H23F6N5O2S — CID 87410294
7-piperazin-1-ium-1-ylidene-3-piperazin-1-yl-1-(trifluoromethyl)phenothiazine;2,2,2-trifluoroacetate (PubChem CID 87410294) has the molecular formula C23H23F6N5O2S and a molecular weight of 547.53 g/mol. Its IUPAC name is 7-piperazin-1-ium-1-ylidene-3-piperazin-1-yl-1-(trifluoromethyl)phenothiazine;2,2,2-trifluoroacetate.
| Compound Name | 7-piperazin-1-ium-1-ylidene-3-piperazin-1-yl-1-(trifluoromethyl)phenothiazine;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87410294 |
| Molecular Formula | C23H23F6N5O2S |
| Molecular Weight | 547.53 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 7-piperazin-1-ium-1-ylidene-3-piperazin-1-yl-1-(trifluoromethyl)phenothiazine;2,2,2-trifluoroacetate |
| SMILES | FC(F)(F)c1cc(N2CCNCC2)cc2sc3cc(=[N+]4CCNCC4)ccc-3nc12.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C21H23F3N5S.C2HF3O2/c22-21(23,24)16-11-15(29-9-5-26-6-10-29)13-19-20(16)27-17-2-1-14(12-18(17)30-19)28-7-3-25-4-8-28;3-2(4,5)1(6)7/h1-2,11-13,25-26H,3-10H2;(H,6,7)/q+1;/p-1 |
| InChIKey | NFBOIQZBEOUBMO-UHFFFAOYSA-M |
| XLogP | 1.50 |
| TPSA | 83.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.53 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|