sodium 1,2-dihydrobenzimidazol-2-ide

C7H5N2Na — CID 87410409

IUPACsodium 1,2-dihydrobenzimidazol-2-ide
SMILES[Na+].[c-]1nc2ccccc2[nH]1
InChIInChI=1S/C7H5N2.Na/c1-2-4-7-6(3-1)8-5-9-7;/h1-4H,(H,8,9);/q-1;+1
InChIKeyPSPMOHQWAUZMTB-UHFFFAOYSA-N
MW140.12 g/mol
LogP-1.63
Rot. Bonds

About sodium 1,2-dihydrobenzimidazol-2-ide

sodium 1,2-dihydrobenzimidazol-2-ide (PubChem CID 87410409) has the molecular formula C7H5N2Na and a molecular weight of 140.12 g/mol. Its IUPAC name is sodium 1,2-dihydrobenzimidazol-2-ide.

Molecular Properties

Compound Namesodium 1,2-dihydrobenzimidazol-2-ide
PubChem CID87410409
Molecular FormulaC7H5N2Na
Molecular Weight140.12 g/mol
Exact Mass140.04
IUPAC Namesodium 1,2-dihydrobenzimidazol-2-ide
SMILES[Na+].[c-]1nc2ccccc2[nH]1
InChIInChI=1S/C7H5N2.Na/c1-2-4-7-6(3-1)8-5-9-7;/h1-4H,(H,8,9);/q-1;+1
InChIKeyPSPMOHQWAUZMTB-UHFFFAOYSA-N
XLogP-1.63
TPSA28.68 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500140.12
LogP ≤ 5-1.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}

Analyze sodium 1,2-dihydrobenzimidazol-2-ide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 1,2-dihydrobenzimidazol-2-ide?
The IUPAC name of sodium 1,2-dihydrobenzimidazol-2-ide (CID 87410409) is sodium 1,2-dihydrobenzimidazol-2-ide.
What is the SMILES notation for sodium 1,2-dihydrobenzimidazol-2-ide?
The canonical SMILES for sodium 1,2-dihydrobenzimidazol-2-ide is [Na+].[c-]1nc2ccccc2[nH]1.
What is the InChIKey of sodium 1,2-dihydrobenzimidazol-2-ide?
The InChIKey is PSPMOHQWAUZMTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N2.Na/c1-2-4-7-6(3-1)8-5-9-7;/h1-4H,(H,8,9);/q-1;+1.
What are the key properties of sodium 1,2-dihydrobenzimidazol-2-ide?
sodium 1,2-dihydrobenzimidazol-2-ide has a molecular weight of 140.12 g/mol, XLogP of -1.63, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1,2-dihydrobenzimidazol-2-ide is sourced from PubChem (CID 87410409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).