C27H42N2O9P2S — CID 87410738
[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methyl-[[ethoxy(hydroxy)phosphoryl]methyl]amino]methylphosphonic acid (PubChem CID 87410738) has the molecular formula C27H42N2O9P2S and a molecular weight of 632.65 g/mol. Its IUPAC name is [[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methyl-[[ethoxy(hydroxy)phosphoryl]methyl]amino]methylphosphonic acid.
| Compound Name | [[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methyl-[[ethoxy(hydroxy)phosphoryl]methyl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 87410738 |
| Molecular Formula | C27H42N2O9P2S |
| Molecular Weight | 632.65 g/mol |
| Exact Mass | 632.21 |
| IUPAC Name | [[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methyl-[[ethoxy(hydroxy)phosphoryl]methyl]amino]methylphosphonic acid |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2cc(CN(CP(=O)(O)O)CP(=O)(O)OCC)c(OC)cc2[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C27H42N2O9P2S/c1-5-8-14-27(6-2)18-41(35,36)25-15-22(17-29(19-39(30,31)32)20-40(33,34)38-7-3)24(37-4)16-23(25)26(28-27)21-12-10-9-11-13-21/h9-13,15-16,26,28H,5-8,14,17-20H2,1-4H3,(H,33,34)(H2,30,31,32)/t26-,27-/m1/s1 |
| InChIKey | HXJNSANYMHNJEN-KAYWLYCHSA-N |
| XLogP | 4.62 |
| TPSA | 162.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.65 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|