About sodium N-(3,3-dimethylbutyl)sulfamate
sodium N-(3,3-dimethylbutyl)sulfamate (PubChem CID 87410763) has the molecular formula C6H14NNaO3S
and a molecular weight of 203.24 g/mol. Its IUPAC name is sodium N-(3,3-dimethylbutyl)sulfamate.
Molecular Properties
| Compound Name | sodium N-(3,3-dimethylbutyl)sulfamate |
| PubChem CID | 87410763 |
| Molecular Formula | C6H14NNaO3S |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | sodium N-(3,3-dimethylbutyl)sulfamate |
| SMILES | CC(C)(C)CCNS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H15NO3S.Na/c1-6(2,3)4-5-7-11(8,9)10;/h7H,4-5H2,1-3H3,(H,8,9,10);/q;+1/p-1 |
| InChIKey | KVFDPIWKATZHCY-UHFFFAOYSA-M |
| XLogP | -2.52 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium N-(3,3-dimethylbutyl)sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium N-(3,3-dimethylbutyl)sulfamate?
The IUPAC name of sodium N-(3,3-dimethylbutyl)sulfamate (CID 87410763) is sodium N-(3,3-dimethylbutyl)sulfamate.
What is the SMILES notation for sodium N-(3,3-dimethylbutyl)sulfamate?
The canonical SMILES for sodium N-(3,3-dimethylbutyl)sulfamate is CC(C)(C)CCNS(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium N-(3,3-dimethylbutyl)sulfamate?
The InChIKey is KVFDPIWKATZHCY-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H15NO3S.Na/c1-6(2,3)4-5-7-11(8,9)10;/h7H,4-5H2,1-3H3,(H,8,9,10);/q;+1/p-1.
What are the key properties of sodium N-(3,3-dimethylbutyl)sulfamate?
sodium N-(3,3-dimethylbutyl)sulfamate has a molecular weight of 203.24 g/mol, XLogP of -2.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium N-(3,3-dimethylbutyl)sulfamate is sourced from PubChem (CID 87410763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).