sodium N-(3,3-dimethylbutyl)sulfamate

C6H14NNaO3S — CID 87410763

IUPACsodium N-(3,3-dimethylbutyl)sulfamate
SMILESCC(C)(C)CCNS(=O)(=O)[O-].[Na+]
InChIInChI=1S/C6H15NO3S.Na/c1-6(2,3)4-5-7-11(8,9)10;/h7H,4-5H2,1-3H3,(H,8,9,10);/q;+1/p-1
InChIKeyKVFDPIWKATZHCY-UHFFFAOYSA-M
MW203.24 g/mol
LogP-2.52
Rot. Bonds3

About sodium N-(3,3-dimethylbutyl)sulfamate

sodium N-(3,3-dimethylbutyl)sulfamate (PubChem CID 87410763) has the molecular formula C6H14NNaO3S and a molecular weight of 203.24 g/mol. Its IUPAC name is sodium N-(3,3-dimethylbutyl)sulfamate.

Molecular Properties

Compound Namesodium N-(3,3-dimethylbutyl)sulfamate
PubChem CID87410763
Molecular FormulaC6H14NNaO3S
Molecular Weight203.24 g/mol
Exact Mass203.06
IUPAC Namesodium N-(3,3-dimethylbutyl)sulfamate
SMILESCC(C)(C)CCNS(=O)(=O)[O-].[Na+]
InChIInChI=1S/C6H15NO3S.Na/c1-6(2,3)4-5-7-11(8,9)10;/h7H,4-5H2,1-3H3,(H,8,9,10);/q;+1/p-1
InChIKeyKVFDPIWKATZHCY-UHFFFAOYSA-M
XLogP-2.52
TPSA69.23 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.24
LogP ≤ 5-2.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sodium N-(3,3-dimethylbutyl)sulfamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium N-(3,3-dimethylbutyl)sulfamate?
The IUPAC name of sodium N-(3,3-dimethylbutyl)sulfamate (CID 87410763) is sodium N-(3,3-dimethylbutyl)sulfamate.
What is the SMILES notation for sodium N-(3,3-dimethylbutyl)sulfamate?
The canonical SMILES for sodium N-(3,3-dimethylbutyl)sulfamate is CC(C)(C)CCNS(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium N-(3,3-dimethylbutyl)sulfamate?
The InChIKey is KVFDPIWKATZHCY-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H15NO3S.Na/c1-6(2,3)4-5-7-11(8,9)10;/h7H,4-5H2,1-3H3,(H,8,9,10);/q;+1/p-1.
What are the key properties of sodium N-(3,3-dimethylbutyl)sulfamate?
sodium N-(3,3-dimethylbutyl)sulfamate has a molecular weight of 203.24 g/mol, XLogP of -2.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium N-(3,3-dimethylbutyl)sulfamate is sourced from PubChem (CID 87410763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).