C10H20N2O4 — CID 87410823
tert-butyl-[1-(methoxymethylamino)-1-oxopropan-2-yl]carbamic acid (PubChem CID 87410823) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is tert-butyl-[1-(methoxymethylamino)-1-oxopropan-2-yl]carbamic acid.
| Compound Name | tert-butyl-[1-(methoxymethylamino)-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87410823 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | tert-butyl-[1-(methoxymethylamino)-1-oxopropan-2-yl]carbamic acid |
| SMILES | COCNC(=O)C(C)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C10H20N2O4/c1-7(8(13)11-6-16-5)12(9(14)15)10(2,3)4/h7H,6H2,1-5H3,(H,11,13)(H,14,15) |
| InChIKey | BCLZMCYACUGCFD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|