About cyclopenta-1,3-diene;2-(oxiran-2-ylmethoxymethyl)oxirane
cyclopenta-1,3-diene;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 87410987) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2-(oxiran-2-ylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;2-(oxiran-2-ylmethoxymethyl)oxirane |
| PubChem CID | 87410987 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | cyclopenta-1,3-diene;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.C1=CCC=C1 |
| InChI | InChI=1S/C6H10O3.C5H6/c1(5-3-8-5)7-2-6-4-9-6;1-2-4-5-3-1/h5-6H,1-4H2;1-4H,5H2 |
| InChIKey | KATCEUDQOMBQKD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;2-(oxiran-2-ylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;2-(oxiran-2-ylmethoxymethyl)oxirane?
The IUPAC name of cyclopenta-1,3-diene;2-(oxiran-2-ylmethoxymethyl)oxirane (CID 87410987) is cyclopenta-1,3-diene;2-(oxiran-2-ylmethoxymethyl)oxirane.
What is the SMILES notation for cyclopenta-1,3-diene;2-(oxiran-2-ylmethoxymethyl)oxirane?
The canonical SMILES for cyclopenta-1,3-diene;2-(oxiran-2-ylmethoxymethyl)oxirane is C(OCC1CO1)C1CO1.C1=CCC=C1.
What is the InChIKey of cyclopenta-1,3-diene;2-(oxiran-2-ylmethoxymethyl)oxirane?
The InChIKey is KATCEUDQOMBQKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C5H6/c1(5-3-8-5)7-2-6-4-9-6;1-2-4-5-3-1/h5-6H,1-4H2;1-4H,5H2.
What are the key properties of cyclopenta-1,3-diene;2-(oxiran-2-ylmethoxymethyl)oxirane?
cyclopenta-1,3-diene;2-(oxiran-2-ylmethoxymethyl)oxirane has a molecular weight of 196.25 g/mol, XLogP of 1.30, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;2-(oxiran-2-ylmethoxymethyl)oxirane is sourced from PubChem (CID 87410987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).