C21H18F6N2O2 — CID 87410990
2-amino-4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phenol;4-phenoxyaniline (PubChem CID 87410990) has the molecular formula C21H18F6N2O2 and a molecular weight of 444.38 g/mol. Its IUPAC name is 2-amino-4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phenol;4-phenoxyaniline.
| Compound Name | 2-amino-4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phenol;4-phenoxyaniline |
|---|---|
| PubChem CID | 87410990 |
| Molecular Formula | C21H18F6N2O2 |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 2-amino-4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phenol;4-phenoxyaniline |
| SMILES | Nc1cc(C(F)(C(F)F)C(F)(F)F)ccc1O.Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11NO.C9H7F6NO/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11;10-7(11)8(12,9(13,14)15)4-1-2-6(17)5(16)3-4/h1-9H,13H2;1-3,7,17H,16H2 |
| InChIKey | ISPQYBWNSOLBMO-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|