C24H24F6N4O2S — CID 87411002
3-(4-methylpiperazin-1-yl)-7-pyrrolidin-1-ium-1-ylidene-1-(trifluoromethyl)phenothiazine;2,2,2-trifluoroacetate (PubChem CID 87411002) has the molecular formula C24H24F6N4O2S and a molecular weight of 546.54 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)-7-pyrrolidin-1-ium-1-ylidene-1-(trifluoromethyl)phenothiazine;2,2,2-trifluoroacetate.
| Compound Name | 3-(4-methylpiperazin-1-yl)-7-pyrrolidin-1-ium-1-ylidene-1-(trifluoromethyl)phenothiazine;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87411002 |
| Molecular Formula | C24H24F6N4O2S |
| Molecular Weight | 546.54 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)-7-pyrrolidin-1-ium-1-ylidene-1-(trifluoromethyl)phenothiazine;2,2,2-trifluoroacetate |
| SMILES | CN1CCN(c2cc(C(F)(F)F)c3nc4ccc(=[N+]5CCCC5)cc-4sc3c2)CC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C22H24F3N4S.C2HF3O2/c1-27-8-10-29(11-9-27)16-12-17(22(23,24)25)21-20(14-16)30-19-13-15(4-5-18(19)26-21)28-6-2-3-7-28;3-2(4,5)1(6)7/h4-5,12-14H,2-3,6-11H2,1H3;(H,6,7)/q+1;/p-1 |
| InChIKey | SPRMNJVHLPGDIO-UHFFFAOYSA-M |
| XLogP | 3.04 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|