About 2-ethoxy-5-(2,3,4-trifluorophenyl)pyridine-4-carbaldehyde
2-ethoxy-5-(2,3,4-trifluorophenyl)pyridine-4-carbaldehyde (PubChem CID 87411775) has the molecular formula C14H10F3NO2
and a molecular weight of 281.23 g/mol. Its IUPAC name is 2-ethoxy-5-(2,3,4-trifluorophenyl)pyridine-4-carbaldehyde.
Molecular Properties
| Compound Name | 2-ethoxy-5-(2,3,4-trifluorophenyl)pyridine-4-carbaldehyde |
| PubChem CID | 87411775 |
| Molecular Formula | C14H10F3NO2 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-ethoxy-5-(2,3,4-trifluorophenyl)pyridine-4-carbaldehyde |
| SMILES | CCOc1cc(C=O)c(-c2ccc(F)c(F)c2F)cn1 |
| InChI | InChI=1S/C14H10F3NO2/c1-2-20-12-5-8(7-19)10(6-18-12)9-3-4-11(15)14(17)13(9)16/h3-7H,2H2,1H3 |
| InChIKey | WNIGDLTWVJTGAW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-5-(2,3,4-trifluorophenyl)pyridine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-5-(2,3,4-trifluorophenyl)pyridine-4-carbaldehyde?
The IUPAC name of 2-ethoxy-5-(2,3,4-trifluorophenyl)pyridine-4-carbaldehyde (CID 87411775) is 2-ethoxy-5-(2,3,4-trifluorophenyl)pyridine-4-carbaldehyde.
What is the SMILES notation for 2-ethoxy-5-(2,3,4-trifluorophenyl)pyridine-4-carbaldehyde?
The canonical SMILES for 2-ethoxy-5-(2,3,4-trifluorophenyl)pyridine-4-carbaldehyde is CCOc1cc(C=O)c(-c2ccc(F)c(F)c2F)cn1.
What is the InChIKey of 2-ethoxy-5-(2,3,4-trifluorophenyl)pyridine-4-carbaldehyde?
The InChIKey is WNIGDLTWVJTGAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3NO2/c1-2-20-12-5-8(7-19)10(6-18-12)9-3-4-11(15)14(17)13(9)16/h3-7H,2H2,1H3.
What are the key properties of 2-ethoxy-5-(2,3,4-trifluorophenyl)pyridine-4-carbaldehyde?
2-ethoxy-5-(2,3,4-trifluorophenyl)pyridine-4-carbaldehyde has a molecular weight of 281.23 g/mol, XLogP of 3.38, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-5-(2,3,4-trifluorophenyl)pyridine-4-carbaldehyde is sourced from PubChem (CID 87411775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).