About 5-O-ethyl 2-O-methyl 3-butoxy-4-oxopyran-2,5-dicarboxylate
5-O-ethyl 2-O-methyl 3-butoxy-4-oxopyran-2,5-dicarboxylate (PubChem CID 87412014) has the molecular formula C14H18O7
and a molecular weight of 298.29 g/mol. Its IUPAC name is 5-O-ethyl 2-O-methyl 3-butoxy-4-oxopyran-2,5-dicarboxylate.
Molecular Properties
| Compound Name | 5-O-ethyl 2-O-methyl 3-butoxy-4-oxopyran-2,5-dicarboxylate |
| PubChem CID | 87412014 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 5-O-ethyl 2-O-methyl 3-butoxy-4-oxopyran-2,5-dicarboxylate |
| SMILES | CCCCOc1c(C(=O)OC)occ(C(=O)OCC)c1=O |
| InChI | InChI=1S/C14H18O7/c1-4-6-7-20-11-10(15)9(13(16)19-5-2)8-21-12(11)14(17)18-3/h8H,4-7H2,1-3H3 |
| InChIKey | WQTCCKUMKQSPNT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-O-ethyl 2-O-methyl 3-butoxy-4-oxopyran-2,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-ethyl 2-O-methyl 3-butoxy-4-oxopyran-2,5-dicarboxylate?
The IUPAC name of 5-O-ethyl 2-O-methyl 3-butoxy-4-oxopyran-2,5-dicarboxylate (CID 87412014) is 5-O-ethyl 2-O-methyl 3-butoxy-4-oxopyran-2,5-dicarboxylate.
What is the SMILES notation for 5-O-ethyl 2-O-methyl 3-butoxy-4-oxopyran-2,5-dicarboxylate?
The canonical SMILES for 5-O-ethyl 2-O-methyl 3-butoxy-4-oxopyran-2,5-dicarboxylate is CCCCOc1c(C(=O)OC)occ(C(=O)OCC)c1=O.
What is the InChIKey of 5-O-ethyl 2-O-methyl 3-butoxy-4-oxopyran-2,5-dicarboxylate?
The InChIKey is WQTCCKUMKQSPNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O7/c1-4-6-7-20-11-10(15)9(13(16)19-5-2)8-21-12(11)14(17)18-3/h8H,4-7H2,1-3H3.
What are the key properties of 5-O-ethyl 2-O-methyl 3-butoxy-4-oxopyran-2,5-dicarboxylate?
5-O-ethyl 2-O-methyl 3-butoxy-4-oxopyran-2,5-dicarboxylate has a molecular weight of 298.29 g/mol, XLogP of 1.78, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-ethyl 2-O-methyl 3-butoxy-4-oxopyran-2,5-dicarboxylate is sourced from PubChem (CID 87412014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).