C24H25N3OS — CID 87412046
5-(5-ethyl-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-(3-isocyano-4-propan-2-yloxyphenyl)-1,3-thiazole (PubChem CID 87412046) has the molecular formula C24H25N3OS and a molecular weight of 403.55 g/mol. Its IUPAC name is 5-(5-ethyl-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-(3-isocyano-4-propan-2-yloxyphenyl)-1,3-thiazole.
| Compound Name | 5-(5-ethyl-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-(3-isocyano-4-propan-2-yloxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 87412046 |
| Molecular Formula | C24H25N3OS |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 5-(5-ethyl-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-(3-isocyano-4-propan-2-yloxyphenyl)-1,3-thiazole |
| SMILES | [C-]#[N+]c1cc(-c2ncc(-c3ccc4c(c3CC)CCNC4)s2)ccc1OC(C)C |
| InChI | InChI=1S/C24H25N3OS/c1-5-18-19-10-11-26-13-17(19)6-8-20(18)23-14-27-24(29-23)16-7-9-22(28-15(2)3)21(12-16)25-4/h6-9,12,14-15,26H,5,10-11,13H2,1-3H3 |
| InChIKey | MQNHKRPYDSSJOH-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 38.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|