About (6S)-6-(4-isocyanophenyl)-1,4-oxazepane
(6S)-6-(4-isocyanophenyl)-1,4-oxazepane (PubChem CID 87412079) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is (6S)-6-(4-isocyanophenyl)-1,4-oxazepane.
Molecular Properties
| Compound Name | (6S)-6-(4-isocyanophenyl)-1,4-oxazepane |
| PubChem CID | 87412079 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (6S)-6-(4-isocyanophenyl)-1,4-oxazepane |
| SMILES | [C-]#[N+]c1ccc([C@H]2CNCCOC2)cc1 |
| InChI | InChI=1S/C12H14N2O/c1-13-12-4-2-10(3-5-12)11-8-14-6-7-15-9-11/h2-5,11,14H,6-9H2/t11-/m0/s1 |
| InChIKey | NQNHMOVKZBBMHZ-NSHDSACASA-N |
| XLogP | 1.94 |
| TPSA | 25.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (6S)-6-(4-isocyanophenyl)-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-6-(4-isocyanophenyl)-1,4-oxazepane?
The IUPAC name of (6S)-6-(4-isocyanophenyl)-1,4-oxazepane (CID 87412079) is (6S)-6-(4-isocyanophenyl)-1,4-oxazepane.
What is the SMILES notation for (6S)-6-(4-isocyanophenyl)-1,4-oxazepane?
The canonical SMILES for (6S)-6-(4-isocyanophenyl)-1,4-oxazepane is [C-]#[N+]c1ccc([C@H]2CNCCOC2)cc1.
What is the InChIKey of (6S)-6-(4-isocyanophenyl)-1,4-oxazepane?
The InChIKey is NQNHMOVKZBBMHZ-NSHDSACASA-N. The full InChI is InChI=1S/C12H14N2O/c1-13-12-4-2-10(3-5-12)11-8-14-6-7-15-9-11/h2-5,11,14H,6-9H2/t11-/m0/s1.
What are the key properties of (6S)-6-(4-isocyanophenyl)-1,4-oxazepane?
(6S)-6-(4-isocyanophenyl)-1,4-oxazepane has a molecular weight of 202.26 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-6-(4-isocyanophenyl)-1,4-oxazepane is sourced from PubChem (CID 87412079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).