C12H16N2O6 — CID 87412369
4-[2-(3-carboxybut-3-enoylamino)ethylamino]-2-methylidene-4-oxobutanoic acid (PubChem CID 87412369) has the molecular formula C12H16N2O6 and a molecular weight of 284.27 g/mol. Its IUPAC name is 4-[2-(3-carboxybut-3-enoylamino)ethylamino]-2-methylidene-4-oxobutanoic acid.
| Compound Name | 4-[2-(3-carboxybut-3-enoylamino)ethylamino]-2-methylidene-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87412369 |
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 4-[2-(3-carboxybut-3-enoylamino)ethylamino]-2-methylidene-4-oxobutanoic acid |
| SMILES | C=C(CC(=O)NCCNC(=O)CC(=C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H16N2O6/c1-7(11(17)18)5-9(15)13-3-4-14-10(16)6-8(2)12(19)20/h1-6H2,(H,13,15)(H,14,16)(H,17,18)(H,19,20) |
| InChIKey | NZPIFQFPWWGTHM-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|