C57H42N4O — CID 87412527
[5-[4-[(3E,8Z,10Z)-dodeca-1,3,5,6,8,10-hexaen-4-yl]-6-naphthalen-2-yl-1,3,5-triazin-2-yl]-11,11-dimethylindeno[1,2-b]carbazol-3-yl]-naphthalen-1-ylmethanone (PubChem CID 87412527) has the molecular formula C57H42N4O and a molecular weight of 798.99 g/mol. Its IUPAC name is [5-[4-[(3E,8Z,10Z)-dodeca-1,3,5,6,8,10-hexaen-4-yl]-6-naphthalen-2-yl-1,3,5-triazin-2-yl]-11,11-dimethylindeno[1,2-b]carbazol-3-yl]-naphthalen-1-ylmethanone.
| Compound Name | [5-[4-[(3E,8Z,10Z)-dodeca-1,3,5,6,8,10-hexaen-4-yl]-6-naphthalen-2-yl-1,3,5-triazin-2-yl]-11,11-dimethylindeno[1,2-b]carbazol-3-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 87412527 |
| Molecular Formula | C57H42N4O |
| Molecular Weight | 798.99 g/mol |
| Exact Mass | 798.34 |
| IUPAC Name | [5-[4-[(3E,8Z,10Z)-dodeca-1,3,5,6,8,10-hexaen-4-yl]-6-naphthalen-2-yl-1,3,5-triazin-2-yl]-11,11-dimethylindeno[1,2-b]carbazol-3-yl]-naphthalen-1-ylmethanone |
| SMILES | C=C/C=C(\C=C=C/C=C\C=C/C)c1nc(-c2ccc3ccccc3c2)nc(-n2c3cc(C(=O)c4cccc5ccccc45)ccc3c3cc4c(cc32)-c2ccccc2C4(C)C)n1 |
| InChI | InChI=1S/C57H42N4O/c1-5-7-8-9-10-11-22-39(19-6-2)54-58-55(42-30-29-37-20-12-13-23-40(37)33-42)60-56(59-54)61-51-34-41(53(62)46-27-18-24-38-21-14-15-25-43(38)46)31-32-45(51)48-35-50-47(36-52(48)61)44-26-16-17-28-49(44)57(50,3)4/h5-10,12-36H,2H2,1,3-4H3/b7-5-,9-8-,39-19+ |
| InChIKey | AKUIAWWUKSUAMU-FMVJSCAYSA-N |
| XLogP | 13.89 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.99 |
| LogP ≤ 5 | 13.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|