About 2-methyl-N-[(3E)-2-methylhexa-3,5-dien-3-yl]butanamide
2-methyl-N-[(3E)-2-methylhexa-3,5-dien-3-yl]butanamide (PubChem CID 87412656) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-methyl-N-[(3E)-2-methylhexa-3,5-dien-3-yl]butanamide.
Molecular Properties
| Compound Name | 2-methyl-N-[(3E)-2-methylhexa-3,5-dien-3-yl]butanamide |
| PubChem CID | 87412656 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 2-methyl-N-[(3E)-2-methylhexa-3,5-dien-3-yl]butanamide |
| SMILES | C=C/C=C(/NC(=O)C(C)CC)C(C)C |
| InChI | InChI=1S/C12H21NO/c1-6-8-11(9(3)4)13-12(14)10(5)7-2/h6,8-10H,1,7H2,2-5H3,(H,13,14)/b11-8+ |
| InChIKey | KIEQWMAMQCNJPW-DHZHZOJOSA-N |
| XLogP | 2.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-[(3E)-2-methylhexa-3,5-dien-3-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[(3E)-2-methylhexa-3,5-dien-3-yl]butanamide?
The IUPAC name of 2-methyl-N-[(3E)-2-methylhexa-3,5-dien-3-yl]butanamide (CID 87412656) is 2-methyl-N-[(3E)-2-methylhexa-3,5-dien-3-yl]butanamide.
What is the SMILES notation for 2-methyl-N-[(3E)-2-methylhexa-3,5-dien-3-yl]butanamide?
The canonical SMILES for 2-methyl-N-[(3E)-2-methylhexa-3,5-dien-3-yl]butanamide is C=C/C=C(/NC(=O)C(C)CC)C(C)C.
What is the InChIKey of 2-methyl-N-[(3E)-2-methylhexa-3,5-dien-3-yl]butanamide?
The InChIKey is KIEQWMAMQCNJPW-DHZHZOJOSA-N. The full InChI is InChI=1S/C12H21NO/c1-6-8-11(9(3)4)13-12(14)10(5)7-2/h6,8-10H,1,7H2,2-5H3,(H,13,14)/b11-8+.
What are the key properties of 2-methyl-N-[(3E)-2-methylhexa-3,5-dien-3-yl]butanamide?
2-methyl-N-[(3E)-2-methylhexa-3,5-dien-3-yl]butanamide has a molecular weight of 195.31 g/mol, XLogP of 2.87, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[(3E)-2-methylhexa-3,5-dien-3-yl]butanamide is sourced from PubChem (CID 87412656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).