C33H37F3N2O5S — CID 87412785
2,2,2-trifluoro-1-[4-[3-[4-[(3E)-6-methyl-1,1-dioxo-8,10-di(propan-2-yl)-5,6-dihydro-2,1λ6,3-benzoxathiazocin-4-yl]phenoxy]propoxy]phenyl]ethanimine (PubChem CID 87412785) has the molecular formula C33H37F3N2O5S and a molecular weight of 630.73 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-[3-[4-[(3E)-6-methyl-1,1-dioxo-8,10-di(propan-2-yl)-5,6-dihydro-2,1λ6,3-benzoxathiazocin-4-yl]phenoxy]propoxy]phenyl]ethanimine.
| Compound Name | 2,2,2-trifluoro-1-[4-[3-[4-[(3E)-6-methyl-1,1-dioxo-8,10-di(propan-2-yl)-5,6-dihydro-2,1λ6,3-benzoxathiazocin-4-yl]phenoxy]propoxy]phenyl]ethanimine |
|---|---|
| PubChem CID | 87412785 |
| Molecular Formula | C33H37F3N2O5S |
| Molecular Weight | 630.73 g/mol |
| Exact Mass | 630.24 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-[3-[4-[(3E)-6-methyl-1,1-dioxo-8,10-di(propan-2-yl)-5,6-dihydro-2,1λ6,3-benzoxathiazocin-4-yl]phenoxy]propoxy]phenyl]ethanimine |
| SMILES | [H]/N=C(\c1ccc(OCCCOc2ccc(/C3=N/OS(=O)(=O)c4c(C(C)C)cc(C(C)C)cc4C(C)C3)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C33H37F3N2O5S/c1-20(2)25-18-28(21(3)4)31-29(19-25)22(5)17-30(38-43-44(31,39)40)23-7-11-26(12-8-23)41-15-6-16-42-27-13-9-24(10-14-27)32(37)33(34,35)36/h7-14,18-22,37H,6,15-17H2,1-5H3/b37-32+,38-30+ |
| InChIKey | WYUWBLCWRGPBJH-ZFUNWFEXSA-N |
| XLogP | 8.33 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.73 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|