C33H27F7O9S2 — CID 87413288
tert-butyl 2-[4-[3-[4-(1,1,2,2,3,3-hexafluoro-3-fluorosulfonylpropyl)sulfonyloxyphenyl]-5-(4-hydroxyphenyl)phenyl]phenoxy]acetate (PubChem CID 87413288) has the molecular formula C33H27F7O9S2 and a molecular weight of 764.69 g/mol. Its IUPAC name is tert-butyl 2-[4-[3-[4-(1,1,2,2,3,3-hexafluoro-3-fluorosulfonylpropyl)sulfonyloxyphenyl]-5-(4-hydroxyphenyl)phenyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[3-[4-(1,1,2,2,3,3-hexafluoro-3-fluorosulfonylpropyl)sulfonyloxyphenyl]-5-(4-hydroxyphenyl)phenyl]phenoxy]acetate |
|---|---|
| PubChem CID | 87413288 |
| Molecular Formula | C33H27F7O9S2 |
| Molecular Weight | 764.69 g/mol |
| Exact Mass | 764.10 |
| IUPAC Name | tert-butyl 2-[4-[3-[4-(1,1,2,2,3,3-hexafluoro-3-fluorosulfonylpropyl)sulfonyloxyphenyl]-5-(4-hydroxyphenyl)phenyl]phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(-c2cc(-c3ccc(O)cc3)cc(-c3ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)F)cc3)c2)cc1 |
| InChI | InChI=1S/C33H27F7O9S2/c1-30(2,3)48-29(42)19-47-27-12-6-21(7-13-27)24-16-23(20-4-10-26(41)11-5-20)17-25(18-24)22-8-14-28(15-9-22)49-51(45,46)33(38,39)31(34,35)32(36,37)50(40,43)44/h4-18,41H,19H2,1-3H3 |
| InChIKey | HCBOMJFHLGZRNB-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.69 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|