C28H26N6O2S — CID 87413494
4-[4-(6-ethoxy-13-methyl-4-piperazin-1-yl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-11-yl)phenyl]benzaldehyde (PubChem CID 87413494) has the molecular formula C28H26N6O2S and a molecular weight of 510.62 g/mol. Its IUPAC name is 4-[4-(6-ethoxy-13-methyl-4-piperazin-1-yl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-11-yl)phenyl]benzaldehyde.
| Compound Name | 4-[4-(6-ethoxy-13-methyl-4-piperazin-1-yl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-11-yl)phenyl]benzaldehyde |
|---|---|
| PubChem CID | 87413494 |
| Molecular Formula | C28H26N6O2S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 4-[4-(6-ethoxy-13-methyl-4-piperazin-1-yl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-11-yl)phenyl]benzaldehyde |
| SMILES | CCOc1nc(N2CCNCC2)nc2c1sc1nc(-c3ccc(-c4ccc(C=O)cc4)cc3)nc(C)c12 |
| InChI | InChI=1S/C28H26N6O2S/c1-3-36-26-24-23(31-28(33-26)34-14-12-29-13-15-34)22-17(2)30-25(32-27(22)37-24)21-10-8-20(9-11-21)19-6-4-18(16-35)5-7-19/h4-11,16,29H,3,12-15H2,1-2H3 |
| InChIKey | DULHARBMCCHANS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|