C12H13BrO3 — CID 87413622
(1S,5S,8R)-11-bromo-5-methylspiro[3-oxatricyclo[5.2.2.01,5]undec-10-ene-8,2'-oxirane]-9-one (PubChem CID 87413622) has the molecular formula C12H13BrO3 and a molecular weight of 285.14 g/mol. Its IUPAC name is (1S,5S,8R)-11-bromo-5-methylspiro[3-oxatricyclo[5.2.2.01,5]undec-10-ene-8,2'-oxirane]-9-one.
| Compound Name | (1S,5S,8R)-11-bromo-5-methylspiro[3-oxatricyclo[5.2.2.01,5]undec-10-ene-8,2'-oxirane]-9-one |
|---|---|
| PubChem CID | 87413622 |
| Molecular Formula | C12H13BrO3 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | (1S,5S,8R)-11-bromo-5-methylspiro[3-oxatricyclo[5.2.2.01,5]undec-10-ene-8,2'-oxirane]-9-one |
| SMILES | C[C@@]12COC[C@]13C=C(Br)C(C2)[C@@]1(CO1)C3=O |
| InChI | InChI=1S/C12H13BrO3/c1-10-2-7-8(13)3-11(10,5-15-4-10)9(14)12(7)6-16-12/h3,7H,2,4-6H2,1H3/t7?,10-,11+,12+/m1/s1 |
| InChIKey | KILTXWDRAHAHQK-BJZBSYJQSA-N |
| XLogP | 1.66 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|