C16H22Br2O3 — CID 87413626
(3R)-1,5-dibromo-7-heptoxyspiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one (PubChem CID 87413626) has the molecular formula C16H22Br2O3 and a molecular weight of 422.16 g/mol. Its IUPAC name is (3R)-1,5-dibromo-7-heptoxyspiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one.
| Compound Name | (3R)-1,5-dibromo-7-heptoxyspiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 87413626 |
| Molecular Formula | C16H22Br2O3 |
| Molecular Weight | 422.16 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | (3R)-1,5-dibromo-7-heptoxyspiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one |
| SMILES | CCCCCCCOC1CC2C(Br)=CC1(Br)C(=O)[C@]21CO1 |
| InChI | InChI=1S/C16H22Br2O3/c1-2-3-4-5-6-7-20-13-8-11-12(17)9-15(13,18)14(19)16(11)10-21-16/h9,11,13H,2-8,10H2,1H3/t11?,13?,15?,16-/m0/s1 |
| InChIKey | YKEPRTJNTOZASM-JKMQXDEJSA-N |
| XLogP | 4.13 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.16 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|