About (3R)-5-iodo-7-(2-propoxyethoxy)spiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one
(3R)-5-iodo-7-(2-propoxyethoxy)spiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one (PubChem CID 87413630) has the molecular formula C14H19IO4
and a molecular weight of 378.21 g/mol. Its IUPAC name is (3R)-5-iodo-7-(2-propoxyethoxy)spiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one.
Molecular Properties
| Compound Name | (3R)-5-iodo-7-(2-propoxyethoxy)spiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one |
| PubChem CID | 87413630 |
| Molecular Formula | C14H19IO4 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | (3R)-5-iodo-7-(2-propoxyethoxy)spiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one |
| SMILES | CCCOCCOC1CC2C(I)=CC1C(=O)[C@]21CO1 |
| InChI | InChI=1S/C14H19IO4/c1-2-3-17-4-5-18-12-7-10-11(15)6-9(12)13(16)14(10)8-19-14/h6,9-10,12H,2-5,7-8H2,1H3/t9?,10?,12?,14-/m0/s1 |
| InChIKey | QNTVKQFJGHJZBH-FGFFJQAFSA-N |
| XLogP | 2.10 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (3R)-5-iodo-7-(2-propoxyethoxy)spiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-5-iodo-7-(2-propoxyethoxy)spiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one?
The IUPAC name of (3R)-5-iodo-7-(2-propoxyethoxy)spiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one (CID 87413630) is (3R)-5-iodo-7-(2-propoxyethoxy)spiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one.
What is the SMILES notation for (3R)-5-iodo-7-(2-propoxyethoxy)spiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one?
The canonical SMILES for (3R)-5-iodo-7-(2-propoxyethoxy)spiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one is CCCOCCOC1CC2C(I)=CC1C(=O)[C@]21CO1.
What is the InChIKey of (3R)-5-iodo-7-(2-propoxyethoxy)spiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one?
The InChIKey is QNTVKQFJGHJZBH-FGFFJQAFSA-N. The full InChI is InChI=1S/C14H19IO4/c1-2-3-17-4-5-18-12-7-10-11(15)6-9(12)13(16)14(10)8-19-14/h6,9-10,12H,2-5,7-8H2,1H3/t9?,10?,12?,14-/m0/s1.
What are the key properties of (3R)-5-iodo-7-(2-propoxyethoxy)spiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one?
(3R)-5-iodo-7-(2-propoxyethoxy)spiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one has a molecular weight of 378.21 g/mol, XLogP of 2.10, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-5-iodo-7-(2-propoxyethoxy)spiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one is sourced from PubChem (CID 87413630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).