C21H28O4 — CID 87413695
ethyl (2E,4E,6E,8E,10E,12E)-15-methoxy-2,6,11-trimethyl-14-oxopentadeca-2,4,6,8,10,12-hexaenoate (PubChem CID 87413695) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is ethyl (2E,4E,6E,8E,10E,12E)-15-methoxy-2,6,11-trimethyl-14-oxopentadeca-2,4,6,8,10,12-hexaenoate.
| Compound Name | ethyl (2E,4E,6E,8E,10E,12E)-15-methoxy-2,6,11-trimethyl-14-oxopentadeca-2,4,6,8,10,12-hexaenoate |
|---|---|
| PubChem CID | 87413695 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | ethyl (2E,4E,6E,8E,10E,12E)-15-methoxy-2,6,11-trimethyl-14-oxopentadeca-2,4,6,8,10,12-hexaenoate |
| SMILES | CCOC(=O)/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C(=O)COC |
| InChI | InChI=1S/C21H28O4/c1-6-25-21(23)19(4)13-9-12-17(2)10-7-8-11-18(3)14-15-20(22)16-24-5/h7-15H,6,16H2,1-5H3/b8-7+,12-9+,15-14+,17-10+,18-11+,19-13+ |
| InChIKey | LAYSWOGYMOKAIO-KYJFMFHKSA-N |
| XLogP | 4.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|