C37H46N2 — CID 87414095
(2E,4E,6E)-2,5-dimethyl-7-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-3-[(E)-2-(2,4,6-trimethylphenyl)prop-1-enyl]hepta-2,4,6-trienenitrile (PubChem CID 87414095) has the molecular formula C37H46N2 and a molecular weight of 518.79 g/mol. Its IUPAC name is (2E,4E,6E)-2,5-dimethyl-7-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-3-[(E)-2-(2,4,6-trimethylphenyl)prop-1-enyl]hepta-2,4,6-trienenitrile.
| Compound Name | (2E,4E,6E)-2,5-dimethyl-7-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-3-[(E)-2-(2,4,6-trimethylphenyl)prop-1-enyl]hepta-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 87414095 |
| Molecular Formula | C37H46N2 |
| Molecular Weight | 518.79 g/mol |
| Exact Mass | 518.37 |
| IUPAC Name | (2E,4E,6E)-2,5-dimethyl-7-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-3-[(E)-2-(2,4,6-trimethylphenyl)prop-1-enyl]hepta-2,4,6-trienenitrile |
| SMILES | CC(/C=C/c1cc2c3c(c1)C(C)(C)CCN3CCC2(C)C)=C\C(\C=C(/C)c1c(C)cc(C)cc1C)=C(\C)C#N |
| InChI | InChI=1S/C37H46N2/c1-24(19-31(29(6)23-38)20-28(5)34-26(3)17-25(2)18-27(34)4)11-12-30-21-32-35-33(22-30)37(9,10)14-16-39(35)15-13-36(32,7)8/h11-12,17-22H,13-16H2,1-10H3/b12-11+,24-19+,28-20+,31-29+ |
| InChIKey | TZKXBDXAFOZBGK-GQUDWPTASA-N |
| XLogP | 9.68 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.79 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|