About [3-(methylaminomethyl)-5-(undecan-6-ylsulfanylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol
[3-(methylaminomethyl)-5-(undecan-6-ylsulfanylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol (PubChem CID 87414099) has the molecular formula C21H39NS2
and a molecular weight of 369.68 g/mol. Its IUPAC name is [3-(methylaminomethyl)-5-(undecan-6-ylsulfanylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol.
Molecular Properties
| Compound Name | [3-(methylaminomethyl)-5-(undecan-6-ylsulfanylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol |
| PubChem CID | 87414099 |
| Molecular Formula | C21H39NS2 |
| Molecular Weight | 369.68 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | [3-(methylaminomethyl)-5-(undecan-6-ylsulfanylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol |
| SMILES | CCCCCC(CCCCC)SCC1=CC(CNC)=CC(CS)C1 |
| InChI | InChI=1S/C21H39NS2/c1-4-6-8-10-21(11-9-7-5-2)24-17-20-13-18(15-22-3)12-19(14-20)16-23/h12-13,19,21-23H,4-11,14-17H2,1-3H3 |
| InChIKey | PSZVWDDZBLRXNU-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.68 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [3-(methylaminomethyl)-5-(undecan-6-ylsulfanylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(methylaminomethyl)-5-(undecan-6-ylsulfanylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol?
The IUPAC name of [3-(methylaminomethyl)-5-(undecan-6-ylsulfanylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol (CID 87414099) is [3-(methylaminomethyl)-5-(undecan-6-ylsulfanylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol.
What is the SMILES notation for [3-(methylaminomethyl)-5-(undecan-6-ylsulfanylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol?
The canonical SMILES for [3-(methylaminomethyl)-5-(undecan-6-ylsulfanylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol is CCCCCC(CCCCC)SCC1=CC(CNC)=CC(CS)C1.
What is the InChIKey of [3-(methylaminomethyl)-5-(undecan-6-ylsulfanylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol?
The InChIKey is PSZVWDDZBLRXNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H39NS2/c1-4-6-8-10-21(11-9-7-5-2)24-17-20-13-18(15-22-3)12-19(14-20)16-23/h12-13,19,21-23H,4-11,14-17H2,1-3H3.
What are the key properties of [3-(methylaminomethyl)-5-(undecan-6-ylsulfanylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol?
[3-(methylaminomethyl)-5-(undecan-6-ylsulfanylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol has a molecular weight of 369.68 g/mol, XLogP of 6.27, 14 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(methylaminomethyl)-5-(undecan-6-ylsulfanylmethyl)cyclohexa-2,4-dien-1-yl]methanethiol is sourced from PubChem (CID 87414099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).