C18H14ClN3O2S — CID 87414111
12-chloro-5-[(4-methoxyphenyl)methyl]-3-sulfanyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 87414111) has the molecular formula C18H14ClN3O2S and a molecular weight of 371.85 g/mol. Its IUPAC name is 12-chloro-5-[(4-methoxyphenyl)methyl]-3-sulfanyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 12-chloro-5-[(4-methoxyphenyl)methyl]-3-sulfanyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 87414111 |
| Molecular Formula | C18H14ClN3O2S |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 12-chloro-5-[(4-methoxyphenyl)methyl]-3-sulfanyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | COc1ccc(Cn2cc(S)c3c([nH]c4ncc(Cl)cc43)c2=O)cc1 |
| InChI | InChI=1S/C18H14ClN3O2S/c1-24-12-4-2-10(3-5-12)8-22-9-14(25)15-13-6-11(19)7-20-17(13)21-16(15)18(22)23/h2-7,9,25H,8H2,1H3,(H,20,21) |
| InChIKey | JQAQMCARRYSZGC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|