C16H16BrNO2 — CID 874144
2-(4-bromophenoxy)-N-(2,4-dimethylphenyl)acetamide (PubChem CID 874144) has the molecular formula C16H16BrNO2 and a molecular weight of 334.21 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-(4-bromophenoxy)-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 874144 |
| Molecular Formula | C16H16BrNO2 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 2-(4-bromophenoxy)-N-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(Br)cc2)c(C)c1 |
| InChI | InChI=1S/C16H16BrNO2/c1-11-3-8-15(12(2)9-11)18-16(19)10-20-14-6-4-13(17)5-7-14/h3-9H,10H2,1-2H3,(H,18,19) |
| InChIKey | VYRMFLIPPMASBB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |