C7H9F7 — CID 87414420
1,1,1,3,3,5,5-heptafluoroheptane (PubChem CID 87414420) has the molecular formula C7H9F7 and a molecular weight of 226.13 g/mol. Its IUPAC name is 1,1,1,3,3,5,5-heptafluoroheptane.
| Compound Name | 1,1,1,3,3,5,5-heptafluoroheptane |
|---|---|
| PubChem CID | 87414420 |
| Molecular Formula | C7H9F7 |
| Molecular Weight | 226.13 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 1,1,1,3,3,5,5-heptafluoroheptane |
| SMILES | CCC(F)(F)CC(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C7H9F7/c1-2-5(8,9)3-6(10,11)4-7(12,13)14/h2-4H2,1H3 |
| InChIKey | FGKRIRUEJXCAMD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.13 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |