C16H12ClF5O3 — CID 87414816
(2,3,4,5,6-pentafluorophenyl) 3-chloro-4-propan-2-yloxycyclohexa-1,3-diene-1-carboxylate (PubChem CID 87414816) has the molecular formula C16H12ClF5O3 and a molecular weight of 382.71 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-chloro-4-propan-2-yloxycyclohexa-1,3-diene-1-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-chloro-4-propan-2-yloxycyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 87414816 |
| Molecular Formula | C16H12ClF5O3 |
| Molecular Weight | 382.71 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-chloro-4-propan-2-yloxycyclohexa-1,3-diene-1-carboxylate |
| SMILES | CC(C)OC1=C(Cl)C=C(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C16H12ClF5O3/c1-6(2)24-9-4-3-7(5-8(9)17)16(23)25-15-13(21)11(19)10(18)12(20)14(15)22/h5-6H,3-4H2,1-2H3 |
| InChIKey | OJMDVDRHOIKBGG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.71 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|