About (2E,3Z)-3-ethylidene-2-prop-2-enylidene-4a,8a-dihydro-4H-chromene
(2E,3Z)-3-ethylidene-2-prop-2-enylidene-4a,8a-dihydro-4H-chromene (PubChem CID 87415159) has the molecular formula C14H16O
and a molecular weight of 200.28 g/mol. Its IUPAC name is (2E,3Z)-3-ethylidene-2-prop-2-enylidene-4a,8a-dihydro-4H-chromene.
Molecular Properties
| Compound Name | (2E,3Z)-3-ethylidene-2-prop-2-enylidene-4a,8a-dihydro-4H-chromene |
| PubChem CID | 87415159 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (2E,3Z)-3-ethylidene-2-prop-2-enylidene-4a,8a-dihydro-4H-chromene |
| SMILES | C=C/C=C1/OC2C=CC=CC2C/C1=C/C |
| InChI | InChI=1S/C14H16O/c1-3-7-13-11(4-2)10-12-8-5-6-9-14(12)15-13/h3-9,12,14H,1,10H2,2H3/b11-4-,13-7+ |
| InChIKey | MHGPGPBCPZOXAS-COKUFYHRSA-N |
| XLogP | 3.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2E,3Z)-3-ethylidene-2-prop-2-enylidene-4a,8a-dihydro-4H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3Z)-3-ethylidene-2-prop-2-enylidene-4a,8a-dihydro-4H-chromene?
The IUPAC name of (2E,3Z)-3-ethylidene-2-prop-2-enylidene-4a,8a-dihydro-4H-chromene (CID 87415159) is (2E,3Z)-3-ethylidene-2-prop-2-enylidene-4a,8a-dihydro-4H-chromene.
What is the SMILES notation for (2E,3Z)-3-ethylidene-2-prop-2-enylidene-4a,8a-dihydro-4H-chromene?
The canonical SMILES for (2E,3Z)-3-ethylidene-2-prop-2-enylidene-4a,8a-dihydro-4H-chromene is C=C/C=C1/OC2C=CC=CC2C/C1=C/C.
What is the InChIKey of (2E,3Z)-3-ethylidene-2-prop-2-enylidene-4a,8a-dihydro-4H-chromene?
The InChIKey is MHGPGPBCPZOXAS-COKUFYHRSA-N. The full InChI is InChI=1S/C14H16O/c1-3-7-13-11(4-2)10-12-8-5-6-9-14(12)15-13/h3-9,12,14H,1,10H2,2H3/b11-4-,13-7+.
What are the key properties of (2E,3Z)-3-ethylidene-2-prop-2-enylidene-4a,8a-dihydro-4H-chromene?
(2E,3Z)-3-ethylidene-2-prop-2-enylidene-4a,8a-dihydro-4H-chromene has a molecular weight of 200.28 g/mol, XLogP of 3.53, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3Z)-3-ethylidene-2-prop-2-enylidene-4a,8a-dihydro-4H-chromene is sourced from PubChem (CID 87415159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).