C20H19FN2O4 — CID 87415211
N-[(2-cyano-4,5-diethoxy-3-fluorophenyl)methyl]-2-formylbenzamide (PubChem CID 87415211) has the molecular formula C20H19FN2O4 and a molecular weight of 370.38 g/mol. Its IUPAC name is N-[(2-cyano-4,5-diethoxy-3-fluorophenyl)methyl]-2-formylbenzamide.
| Compound Name | N-[(2-cyano-4,5-diethoxy-3-fluorophenyl)methyl]-2-formylbenzamide |
|---|---|
| PubChem CID | 87415211 |
| Molecular Formula | C20H19FN2O4 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-[(2-cyano-4,5-diethoxy-3-fluorophenyl)methyl]-2-formylbenzamide |
| SMILES | CCOc1cc(CNC(=O)c2ccccc2C=O)c(C#N)c(F)c1OCC |
| InChI | InChI=1S/C20H19FN2O4/c1-3-26-17-9-14(16(10-22)18(21)19(17)27-4-2)11-23-20(25)15-8-6-5-7-13(15)12-24/h5-9,12H,3-4,11H2,1-2H3,(H,23,25) |
| InChIKey | PDGIFKOVZJSVBH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|