C10H23NO2 — CID 8741528
(2R)-1-[(2-methylpropan-2-yl)oxy]-3-(propan-2-ylamino)propan-2-ol (PubChem CID 8741528) has the molecular formula C10H23NO2 and a molecular weight of 189.30 g/mol. Its IUPAC name is (2R)-1-[(2-methylpropan-2-yl)oxy]-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | (2R)-1-[(2-methylpropan-2-yl)oxy]-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 8741528 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | (2R)-1-[(2-methylpropan-2-yl)oxy]-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NC[C@@H](O)COC(C)(C)C |
| InChI | InChI=1S/C10H23NO2/c1-8(2)11-6-9(12)7-13-10(3,4)5/h8-9,11-12H,6-7H2,1-5H3/t9-/m1/s1 |
| InChIKey | RQVBJQASVOZVLR-SECBINFHSA-N |
| XLogP | 1.16 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |