C10H12F5NO2S — CID 87415339
N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,1,2,2,2-pentafluoroethanesulfonamide (PubChem CID 87415339) has the molecular formula C10H12F5NO2S and a molecular weight of 305.27 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,1,2,2,2-pentafluoroethanesulfonamide.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,1,2,2,2-pentafluoroethanesulfonamide |
|---|---|
| PubChem CID | 87415339 |
| Molecular Formula | C10H12F5NO2S |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,1,2,2,2-pentafluoroethanesulfonamide |
| SMILES | O=S(=O)(NCC1CC2C=CC1C2)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H12F5NO2S/c11-9(12,13)10(14,15)19(17,18)16-5-8-4-6-1-2-7(8)3-6/h1-2,6-8,16H,3-5H2 |
| InChIKey | OHZYNRGKHKZRKH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|