About [(Z,2E)-2-prop-2-enylidenehex-3-enyl]hydrazine
[(Z,2E)-2-prop-2-enylidenehex-3-enyl]hydrazine (PubChem CID 87415364) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is [(Z,2E)-2-prop-2-enylidenehex-3-enyl]hydrazine.
Molecular Properties
| Compound Name | [(Z,2E)-2-prop-2-enylidenehex-3-enyl]hydrazine |
| PubChem CID | 87415364 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | [(Z,2E)-2-prop-2-enylidenehex-3-enyl]hydrazine |
| SMILES | C=C/C=C(\C=C/CC)CNN |
| InChI | InChI=1S/C9H16N2/c1-3-5-7-9(6-4-2)8-11-10/h4-7,11H,2-3,8,10H2,1H3/b7-5-,9-6+ |
| InChIKey | OPTTVJVAGLJNJY-XCZNYUDNSA-N |
| XLogP | 1.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(Z,2E)-2-prop-2-enylidenehex-3-enyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,2E)-2-prop-2-enylidenehex-3-enyl]hydrazine?
The IUPAC name of [(Z,2E)-2-prop-2-enylidenehex-3-enyl]hydrazine (CID 87415364) is [(Z,2E)-2-prop-2-enylidenehex-3-enyl]hydrazine.
What is the SMILES notation for [(Z,2E)-2-prop-2-enylidenehex-3-enyl]hydrazine?
The canonical SMILES for [(Z,2E)-2-prop-2-enylidenehex-3-enyl]hydrazine is C=C/C=C(\C=C/CC)CNN.
What is the InChIKey of [(Z,2E)-2-prop-2-enylidenehex-3-enyl]hydrazine?
The InChIKey is OPTTVJVAGLJNJY-XCZNYUDNSA-N. The full InChI is InChI=1S/C9H16N2/c1-3-5-7-9(6-4-2)8-11-10/h4-7,11H,2-3,8,10H2,1H3/b7-5-,9-6+.
What are the key properties of [(Z,2E)-2-prop-2-enylidenehex-3-enyl]hydrazine?
[(Z,2E)-2-prop-2-enylidenehex-3-enyl]hydrazine has a molecular weight of 152.24 g/mol, XLogP of 1.53, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,2E)-2-prop-2-enylidenehex-3-enyl]hydrazine is sourced from PubChem (CID 87415364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).