C14H21N — CID 87415404
(2Z,4E,6Z)-N,N-dimethyl-5-prop-1-en-2-ylnona-2,4,6,8-tetraen-4-amine (PubChem CID 87415404) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (2Z,4E,6Z)-N,N-dimethyl-5-prop-1-en-2-ylnona-2,4,6,8-tetraen-4-amine.
| Compound Name | (2Z,4E,6Z)-N,N-dimethyl-5-prop-1-en-2-ylnona-2,4,6,8-tetraen-4-amine |
|---|---|
| PubChem CID | 87415404 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (2Z,4E,6Z)-N,N-dimethyl-5-prop-1-en-2-ylnona-2,4,6,8-tetraen-4-amine |
| SMILES | C=C/C=C\C(C(=C)C)=C(\C=C/C)N(C)C |
| InChI | InChI=1S/C14H21N/c1-7-9-11-13(12(3)4)14(10-8-2)15(5)6/h7-11H,1,3H2,2,4-6H3/b10-8-,11-9-,14-13+ |
| InChIKey | LOMYRIXASUFJEF-KUMKROPXSA-N |
| XLogP | 3.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|