C14H17N3O4 — CID 87416022
2-[4-[2-(hydroxyiminomethyl)phenoxy]piperidin-1-yl]-2-oxoacetamide (PubChem CID 87416022) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-[4-[2-(hydroxyiminomethyl)phenoxy]piperidin-1-yl]-2-oxoacetamide.
| Compound Name | 2-[4-[2-(hydroxyiminomethyl)phenoxy]piperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 87416022 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-[4-[2-(hydroxyiminomethyl)phenoxy]piperidin-1-yl]-2-oxoacetamide |
| SMILES | NC(=O)C(=O)N1CCC(Oc2ccccc2C=NO)CC1 |
| InChI | InChI=1S/C14H17N3O4/c15-13(18)14(19)17-7-5-11(6-8-17)21-12-4-2-1-3-10(12)9-16-20/h1-4,9,11,20H,5-8H2,(H2,15,18) |
| InChIKey | XHSBTGIEWKLBCK-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|