About (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-methylpentanedithioate
(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-methylpentanedithioate (PubChem CID 87416032) has the molecular formula C10H16NO3S2+
and a molecular weight of 262.38 g/mol. Its IUPAC name is (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-methylpentanedithioate.
Molecular Properties
| Compound Name | (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-methylpentanedithioate |
| PubChem CID | 87416032 |
| Molecular Formula | C10H16NO3S2+ |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-methylpentanedithioate |
| SMILES | CC(C)CCC(=S)S[N+]1(O)C(=O)CCC1=O |
| InChI | InChI=1S/C10H16NO3S2/c1-7(2)3-6-10(15)16-11(14)8(12)4-5-9(11)13/h7,14H,3-6H2,1-2H3/q+1 |
| InChIKey | IANDIKGOFBZOJM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-methylpentanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-methylpentanedithioate?
The IUPAC name of (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-methylpentanedithioate (CID 87416032) is (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-methylpentanedithioate.
What is the SMILES notation for (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-methylpentanedithioate?
The canonical SMILES for (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-methylpentanedithioate is CC(C)CCC(=S)S[N+]1(O)C(=O)CCC1=O.
What is the InChIKey of (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-methylpentanedithioate?
The InChIKey is IANDIKGOFBZOJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16NO3S2/c1-7(2)3-6-10(15)16-11(14)8(12)4-5-9(11)13/h7,14H,3-6H2,1-2H3/q+1.
What are the key properties of (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-methylpentanedithioate?
(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-methylpentanedithioate has a molecular weight of 262.38 g/mol, XLogP of 2.45, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-methylpentanedithioate is sourced from PubChem (CID 87416032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).