About (4S,6E)-nona-6,8-dien-4-ol
(4S,6E)-nona-6,8-dien-4-ol (PubChem CID 87416285) has the molecular formula C9H16O
and a molecular weight of 140.23 g/mol. Its IUPAC name is (4S,6E)-nona-6,8-dien-4-ol.
Molecular Properties
| Compound Name | (4S,6E)-nona-6,8-dien-4-ol |
| PubChem CID | 87416285 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (4S,6E)-nona-6,8-dien-4-ol |
| SMILES | C=C/C=C/C[C@@H](O)CCC |
| InChI | InChI=1S/C9H16O/c1-3-5-6-8-9(10)7-4-2/h3,5-6,9-10H,1,4,7-8H2,2H3/b6-5+/t9-/m0/s1 |
| InChIKey | PLOCAOROOZYEOA-CYNONHLPSA-N |
| XLogP | 2.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4S,6E)-nona-6,8-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,6E)-nona-6,8-dien-4-ol?
The IUPAC name of (4S,6E)-nona-6,8-dien-4-ol (CID 87416285) is (4S,6E)-nona-6,8-dien-4-ol.
What is the SMILES notation for (4S,6E)-nona-6,8-dien-4-ol?
The canonical SMILES for (4S,6E)-nona-6,8-dien-4-ol is C=C/C=C/C[C@@H](O)CCC.
What is the InChIKey of (4S,6E)-nona-6,8-dien-4-ol?
The InChIKey is PLOCAOROOZYEOA-CYNONHLPSA-N. The full InChI is InChI=1S/C9H16O/c1-3-5-6-8-9(10)7-4-2/h3,5-6,9-10H,1,4,7-8H2,2H3/b6-5+/t9-/m0/s1.
What are the key properties of (4S,6E)-nona-6,8-dien-4-ol?
(4S,6E)-nona-6,8-dien-4-ol has a molecular weight of 140.23 g/mol, XLogP of 2.28, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,6E)-nona-6,8-dien-4-ol is sourced from PubChem (CID 87416285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).