C17H26F5NO3 — CID 87416403
tert-butyl [(2S)-2-[(Z)-7,7,8,8,8-pentafluorooct-1-enyl]pyrrolidin-1-yl] carbonate (PubChem CID 87416403) has the molecular formula C17H26F5NO3 and a molecular weight of 387.39 g/mol. Its IUPAC name is tert-butyl [(2S)-2-[(Z)-7,7,8,8,8-pentafluorooct-1-enyl]pyrrolidin-1-yl] carbonate.
| Compound Name | tert-butyl [(2S)-2-[(Z)-7,7,8,8,8-pentafluorooct-1-enyl]pyrrolidin-1-yl] carbonate |
|---|---|
| PubChem CID | 87416403 |
| Molecular Formula | C17H26F5NO3 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | tert-butyl [(2S)-2-[(Z)-7,7,8,8,8-pentafluorooct-1-enyl]pyrrolidin-1-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)ON1CCC[C@H]1/C=C\CCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H26F5NO3/c1-15(2,3)25-14(24)26-23-12-8-10-13(23)9-6-4-5-7-11-16(18,19)17(20,21)22/h6,9,13H,4-5,7-8,10-12H2,1-3H3/b9-6-/t13-/m1/s1 |
| InChIKey | BMYONYGUXMWROI-OYVUYXNMSA-N |
| XLogP | 5.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|