C16H24F5NO3 — CID 87416465
tert-butyl [(2S)-2-[(Z)-6,6,7,7,7-pentafluorohept-1-enyl]pyrrolidin-1-yl] carbonate (PubChem CID 87416465) has the molecular formula C16H24F5NO3 and a molecular weight of 373.36 g/mol. Its IUPAC name is tert-butyl [(2S)-2-[(Z)-6,6,7,7,7-pentafluorohept-1-enyl]pyrrolidin-1-yl] carbonate.
| Compound Name | tert-butyl [(2S)-2-[(Z)-6,6,7,7,7-pentafluorohept-1-enyl]pyrrolidin-1-yl] carbonate |
|---|---|
| PubChem CID | 87416465 |
| Molecular Formula | C16H24F5NO3 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | tert-butyl [(2S)-2-[(Z)-6,6,7,7,7-pentafluorohept-1-enyl]pyrrolidin-1-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)ON1CCC[C@H]1/C=C\CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H24F5NO3/c1-14(2,3)24-13(23)25-22-11-7-9-12(22)8-5-4-6-10-15(17,18)16(19,20)21/h5,8,12H,4,6-7,9-11H2,1-3H3/b8-5-/t12-/m1/s1 |
| InChIKey | OZHRGXWOLCBRRM-VVEJJEBESA-N |
| XLogP | 5.24 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|