About prop-2-enyl 2-methylidene-3,4-bis(2-methylprop-2-enoyloxy)butanoate
prop-2-enyl 2-methylidene-3,4-bis(2-methylprop-2-enoyloxy)butanoate (PubChem CID 87416538) has the molecular formula C16H20O6
and a molecular weight of 308.33 g/mol. Its IUPAC name is prop-2-enyl 2-methylidene-3,4-bis(2-methylprop-2-enoyloxy)butanoate.
Molecular Properties
| Compound Name | prop-2-enyl 2-methylidene-3,4-bis(2-methylprop-2-enoyloxy)butanoate |
| PubChem CID | 87416538 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | prop-2-enyl 2-methylidene-3,4-bis(2-methylprop-2-enoyloxy)butanoate |
| SMILES | C=CCOC(=O)C(=C)C(COC(=O)C(=C)C)OC(=O)C(=C)C |
| InChI | InChI=1S/C16H20O6/c1-7-8-20-16(19)12(6)13(22-15(18)11(4)5)9-21-14(17)10(2)3/h7,13H,1-2,4,6,8-9H2,3,5H3 |
| InChIKey | ZWHVGESFYFZIGH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 2-methylidene-3,4-bis(2-methylprop-2-enoyloxy)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 2-methylidene-3,4-bis(2-methylprop-2-enoyloxy)butanoate?
The IUPAC name of prop-2-enyl 2-methylidene-3,4-bis(2-methylprop-2-enoyloxy)butanoate (CID 87416538) is prop-2-enyl 2-methylidene-3,4-bis(2-methylprop-2-enoyloxy)butanoate.
What is the SMILES notation for prop-2-enyl 2-methylidene-3,4-bis(2-methylprop-2-enoyloxy)butanoate?
The canonical SMILES for prop-2-enyl 2-methylidene-3,4-bis(2-methylprop-2-enoyloxy)butanoate is C=CCOC(=O)C(=C)C(COC(=O)C(=C)C)OC(=O)C(=C)C.
What is the InChIKey of prop-2-enyl 2-methylidene-3,4-bis(2-methylprop-2-enoyloxy)butanoate?
The InChIKey is ZWHVGESFYFZIGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O6/c1-7-8-20-16(19)12(6)13(22-15(18)11(4)5)9-21-14(17)10(2)3/h7,13H,1-2,4,6,8-9H2,3,5H3.
What are the key properties of prop-2-enyl 2-methylidene-3,4-bis(2-methylprop-2-enoyloxy)butanoate?
prop-2-enyl 2-methylidene-3,4-bis(2-methylprop-2-enoyloxy)butanoate has a molecular weight of 308.33 g/mol, XLogP of 1.88, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 2-methylidene-3,4-bis(2-methylprop-2-enoyloxy)butanoate is sourced from PubChem (CID 87416538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).