C10H15FN2O3S — CID 87416569
3-[(3R,4R)-3-fluoro-1-(2-hydroxyethyl)piperidin-4-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 87416569) has the molecular formula C10H15FN2O3S and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-[(3R,4R)-3-fluoro-1-(2-hydroxyethyl)piperidin-4-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[(3R,4R)-3-fluoro-1-(2-hydroxyethyl)piperidin-4-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87416569 |
| Molecular Formula | C10H15FN2O3S |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 3-[(3R,4R)-3-fluoro-1-(2-hydroxyethyl)piperidin-4-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1CSC(=O)N1[C@@H]1CCN(CCO)C[C@H]1F |
| InChI | InChI=1S/C10H15FN2O3S/c11-7-5-12(3-4-14)2-1-8(7)13-9(15)6-17-10(13)16/h7-8,14H,1-6H2/t7-,8-/m1/s1 |
| InChIKey | UZQNRANDYYDOJD-HTQZYQBOSA-N |
| XLogP | 0.09 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|