About 4-ethyl-4-(1-hydroxyprop-2-enyl)hepta-1,6-diene-3,5-diol
4-ethyl-4-(1-hydroxyprop-2-enyl)hepta-1,6-diene-3,5-diol (PubChem CID 87416573) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is 4-ethyl-4-(1-hydroxyprop-2-enyl)hepta-1,6-diene-3,5-diol.
Molecular Properties
| Compound Name | 4-ethyl-4-(1-hydroxyprop-2-enyl)hepta-1,6-diene-3,5-diol |
| PubChem CID | 87416573 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 4-ethyl-4-(1-hydroxyprop-2-enyl)hepta-1,6-diene-3,5-diol |
| SMILES | C=CC(O)C(CC)(C(O)C=C)C(O)C=C |
| InChI | InChI=1S/C12H20O3/c1-5-9(13)12(8-4,10(14)6-2)11(15)7-3/h5-7,9-11,13-15H,1-3,8H2,4H3 |
| InChIKey | XFJYWUSBMQHHBB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-4-(1-hydroxyprop-2-enyl)hepta-1,6-diene-3,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-4-(1-hydroxyprop-2-enyl)hepta-1,6-diene-3,5-diol?
The IUPAC name of 4-ethyl-4-(1-hydroxyprop-2-enyl)hepta-1,6-diene-3,5-diol (CID 87416573) is 4-ethyl-4-(1-hydroxyprop-2-enyl)hepta-1,6-diene-3,5-diol.
What is the SMILES notation for 4-ethyl-4-(1-hydroxyprop-2-enyl)hepta-1,6-diene-3,5-diol?
The canonical SMILES for 4-ethyl-4-(1-hydroxyprop-2-enyl)hepta-1,6-diene-3,5-diol is C=CC(O)C(CC)(C(O)C=C)C(O)C=C.
What is the InChIKey of 4-ethyl-4-(1-hydroxyprop-2-enyl)hepta-1,6-diene-3,5-diol?
The InChIKey is XFJYWUSBMQHHBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-5-9(13)12(8-4,10(14)6-2)11(15)7-3/h5-7,9-11,13-15H,1-3,8H2,4H3.
What are the key properties of 4-ethyl-4-(1-hydroxyprop-2-enyl)hepta-1,6-diene-3,5-diol?
4-ethyl-4-(1-hydroxyprop-2-enyl)hepta-1,6-diene-3,5-diol has a molecular weight of 212.29 g/mol, XLogP of 1.02, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-4-(1-hydroxyprop-2-enyl)hepta-1,6-diene-3,5-diol is sourced from PubChem (CID 87416573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).