C48H48F2N12O4S2 — CID 87416639
1,2-bis[6-fluoro-8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis[4-(4-methylpiperazin-1-yl)phenyl]hydrazine (PubChem CID 87416639) has the molecular formula C48H48F2N12O4S2 and a molecular weight of 959.12 g/mol. Its IUPAC name is 1,2-bis[6-fluoro-8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis[4-(4-methylpiperazin-1-yl)phenyl]hydrazine.
| Compound Name | 1,2-bis[6-fluoro-8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis[4-(4-methylpiperazin-1-yl)phenyl]hydrazine |
|---|---|
| PubChem CID | 87416639 |
| Molecular Formula | C48H48F2N12O4S2 |
| Molecular Weight | 959.12 g/mol |
| Exact Mass | 958.33 |
| IUPAC Name | 1,2-bis[6-fluoro-8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis[4-(4-methylpiperazin-1-yl)phenyl]hydrazine |
| SMILES | CN1CCN(c2ccc(N(c3nc4c(-c5ccc(S(C)(=O)=O)cc5)cc(F)cn4n3)N(c3ccc(N4CCN(C)CC4)cc3)c3nc4c(-c5ccc(S(C)(=O)=O)cc5)cc(F)cn4n3)cc2)CC1 |
| InChI | InChI=1S/C48H48F2N12O4S2/c1-55-21-25-57(26-22-55)37-9-13-39(14-10-37)61(47-51-45-43(29-35(49)31-59(45)53-47)33-5-17-41(18-6-33)67(3,63)64)62(40-15-11-38(12-16-40)58-27-23-56(2)24-28-58)48-52-46-44(30-36(50)32-60(46)54-48)34-7-19-42(20-8-34)68(4,65)66/h5-20,29-32H,21-28H2,1-4H3 |
| InChIKey | IRBFTCDFDHWEFY-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 148.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.12 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|