C15H13ClN2O2 — CID 87416694
[4-[(E)-2-(6-chloro-2-pyridinyl)ethenyl]phenyl]-methylcarbamic acid (PubChem CID 87416694) has the molecular formula C15H13ClN2O2 and a molecular weight of 288.73 g/mol. Its IUPAC name is [4-[(E)-2-(6-chloro-2-pyridinyl)ethenyl]phenyl]-methylcarbamic acid.
| Compound Name | [4-[(E)-2-(6-chloro-2-pyridinyl)ethenyl]phenyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 87416694 |
| Molecular Formula | C15H13ClN2O2 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | [4-[(E)-2-(6-chloro-2-pyridinyl)ethenyl]phenyl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)c1ccc(/C=C/c2cccc(Cl)n2)cc1 |
| InChI | InChI=1S/C15H13ClN2O2/c1-18(15(19)20)13-9-6-11(7-10-13)5-8-12-3-2-4-14(16)17-12/h2-10H,1H3,(H,19,20)/b8-5+ |
| InChIKey | WGCOMMMMIQWFQP-VMPITWQZSA-N |
| XLogP | 4.02 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|