C22H26ClN5O5S — CID 87416819
[(Z)-1-aminoethylideneamino] 5-[[(2R)-2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylpropanoyl]amino]pyrazine-2-carboxylate (PubChem CID 87416819) has the molecular formula C22H26ClN5O5S and a molecular weight of 508.00 g/mol. Its IUPAC name is [(Z)-1-aminoethylideneamino] 5-[[(2R)-2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylpropanoyl]amino]pyrazine-2-carboxylate.
| Compound Name | [(Z)-1-aminoethylideneamino] 5-[[(2R)-2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylpropanoyl]amino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 87416819 |
| Molecular Formula | C22H26ClN5O5S |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | [(Z)-1-aminoethylideneamino] 5-[[(2R)-2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylpropanoyl]amino]pyrazine-2-carboxylate |
| SMILES | C/C(N)=N/OC(=O)c1cnc(NC(=O)[C@H](CC2CCCC2)c2ccc(S(C)(=O)=O)c(Cl)c2)cn1 |
| InChI | InChI=1S/C22H26ClN5O5S/c1-13(24)28-33-22(30)18-11-26-20(12-25-18)27-21(29)16(9-14-5-3-4-6-14)15-7-8-19(17(23)10-15)34(2,31)32/h7-8,10-12,14,16H,3-6,9H2,1-2H3,(H2,24,28)(H,26,27,29)/t16-/m1/s1 |
| InChIKey | GPGMRSUIUZBWCW-MRXNPFEDSA-N |
| XLogP | 3.29 |
| TPSA | 153.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|