C10H17N3O2S2 — CID 87416980
5-[(2R,6S)-2,6-dimethylpiperidin-1-yl]sulfonyl-1,3-thiazol-2-amine (PubChem CID 87416980) has the molecular formula C10H17N3O2S2 and a molecular weight of 275.40 g/mol. Its IUPAC name is 5-[(2R,6S)-2,6-dimethylpiperidin-1-yl]sulfonyl-1,3-thiazol-2-amine.
| Compound Name | 5-[(2R,6S)-2,6-dimethylpiperidin-1-yl]sulfonyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 87416980 |
| Molecular Formula | C10H17N3O2S2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 5-[(2R,6S)-2,6-dimethylpiperidin-1-yl]sulfonyl-1,3-thiazol-2-amine |
| SMILES | C[C@@H]1CCC[C@H](C)N1S(=O)(=O)c1cnc(N)s1 |
| InChI | InChI=1S/C10H17N3O2S2/c1-7-4-3-5-8(2)13(7)17(14,15)9-6-12-10(11)16-9/h6-8H,3-5H2,1-2H3,(H2,11,12)/t7-,8+ |
| InChIKey | BPEVLHJSCMFVBJ-OCAPTIKFSA-N |
| XLogP | 1.68 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |