About 2-amino-4-ethyl-1,3-benzothiazole-6-carboxylic acid
2-amino-4-ethyl-1,3-benzothiazole-6-carboxylic acid (PubChem CID 87417576) has the molecular formula C10H10N2O2S
and a molecular weight of 222.27 g/mol. Its IUPAC name is 2-amino-4-ethyl-1,3-benzothiazole-6-carboxylic acid.
Molecular Properties
| Compound Name | 2-amino-4-ethyl-1,3-benzothiazole-6-carboxylic acid |
| PubChem CID | 87417576 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 2-amino-4-ethyl-1,3-benzothiazole-6-carboxylic acid |
| SMILES | CCc1cc(C(=O)O)cc2sc(N)nc12 |
| InChI | InChI=1S/C10H10N2O2S/c1-2-5-3-6(9(13)14)4-7-8(5)12-10(11)15-7/h3-4H,2H2,1H3,(H2,11,12)(H,13,14) |
| InChIKey | HVPWKHDDGNGESP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4-ethyl-1,3-benzothiazole-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-ethyl-1,3-benzothiazole-6-carboxylic acid?
The IUPAC name of 2-amino-4-ethyl-1,3-benzothiazole-6-carboxylic acid (CID 87417576) is 2-amino-4-ethyl-1,3-benzothiazole-6-carboxylic acid.
What is the SMILES notation for 2-amino-4-ethyl-1,3-benzothiazole-6-carboxylic acid?
The canonical SMILES for 2-amino-4-ethyl-1,3-benzothiazole-6-carboxylic acid is CCc1cc(C(=O)O)cc2sc(N)nc12.
What is the InChIKey of 2-amino-4-ethyl-1,3-benzothiazole-6-carboxylic acid?
The InChIKey is HVPWKHDDGNGESP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2S/c1-2-5-3-6(9(13)14)4-7-8(5)12-10(11)15-7/h3-4H,2H2,1H3,(H2,11,12)(H,13,14).
What are the key properties of 2-amino-4-ethyl-1,3-benzothiazole-6-carboxylic acid?
2-amino-4-ethyl-1,3-benzothiazole-6-carboxylic acid has a molecular weight of 222.27 g/mol, XLogP of 2.14, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-ethyl-1,3-benzothiazole-6-carboxylic acid is sourced from PubChem (CID 87417576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).